C20H21FO6 — CID 167445564
(E)-3-(3-fluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 167445564) has the molecular formula C20H21FO6 and a molecular weight of 376.38 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-fluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167445564 |
| Molecular Formula | C20H21FO6 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OC)cc(OCOC)c1C(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C20H21FO6/c1-23-12-26-18-10-16(25-3)11-19(27-13-24-2)20(18)17(22)8-7-14-5-4-6-15(21)9-14/h4-11H,12-13H2,1-3H3/b8-7+ |
| InChIKey | FMBBJVWWBCTQBT-BQYQJAHWSA-N |
| XLogP | 3.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|