C20H20F2O6 — CID 167445562
(E)-3-(2,5-difluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 167445562) has the molecular formula C20H20F2O6 and a molecular weight of 394.37 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167445562 |
| Molecular Formula | C20H20F2O6 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[4-methoxy-2,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OC)cc(OCOC)c1C(=O)/C=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C20H20F2O6/c1-24-11-27-18-9-15(26-3)10-19(28-12-25-2)20(18)17(23)7-4-13-8-14(21)5-6-16(13)22/h4-10H,11-12H2,1-3H3/b7-4+ |
| InChIKey | BXGUVSUVUCYHPG-QPJJXVBHSA-N |
| XLogP | 3.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|