C24H24F2O5 — CID 123265992
4-[3-(2,4-difluorophenyl)prop-2-enoyl]-5-methoxy-3-(methoxymethoxy)-2-(3-methylbut-2-enyl)benzaldehyde (PubChem CID 123265992) has the molecular formula C24H24F2O5 and a molecular weight of 430.45 g/mol. Its IUPAC name is 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-5-methoxy-3-(methoxymethoxy)-2-(3-methylbut-2-enyl)benzaldehyde.
| Compound Name | 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-5-methoxy-3-(methoxymethoxy)-2-(3-methylbut-2-enyl)benzaldehyde |
|---|---|
| PubChem CID | 123265992 |
| Molecular Formula | C24H24F2O5 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-[3-(2,4-difluorophenyl)prop-2-enoyl]-5-methoxy-3-(methoxymethoxy)-2-(3-methylbut-2-enyl)benzaldehyde |
| SMILES | COCOc1c(CC=C(C)C)c(C=O)cc(OC)c1C(=O)C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C24H24F2O5/c1-15(2)5-9-19-17(13-27)11-22(30-4)23(24(19)31-14-29-3)21(28)10-7-16-6-8-18(25)12-20(16)26/h5-8,10-13H,9,14H2,1-4H3 |
| InChIKey | TUBQQZNHBGXIRP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|