C26H31FO7 — CID 86273903
(E)-3-(3-fluoro-4-methoxyphenyl)-1-[6-methoxy-2,4-bis(methoxymethoxy)-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one (PubChem CID 86273903) has the molecular formula C26H31FO7 and a molecular weight of 474.53 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-1-[6-methoxy-2,4-bis(methoxymethoxy)-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[6-methoxy-2,4-bis(methoxymethoxy)-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 86273903 |
| Molecular Formula | C26H31FO7 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-1-[6-methoxy-2,4-bis(methoxymethoxy)-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OC)c(C(=O)/C=C/c2ccc(OC)c(F)c2)c(OCOC)c1CC=C(C)C |
| InChI | InChI=1S/C26H31FO7/c1-17(2)7-10-19-23(33-15-29-3)14-24(32-6)25(26(19)34-16-30-4)21(28)11-8-18-9-12-22(31-5)20(27)13-18/h7-9,11-14H,10,15-16H2,1-6H3/b11-8+ |
| InChIKey | IZVYUDSXABIGTC-DHZHZOJOSA-N |
| XLogP | 5.21 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|