C27H34O9 — CID 168878103
1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(3-methylbut-3-enyl)phenyl]-3-[4-methoxy-3-(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 168878103) has the molecular formula C27H34O9 and a molecular weight of 502.56 g/mol. Its IUPAC name is 1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(3-methylbut-3-enyl)phenyl]-3-[4-methoxy-3-(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(3-methylbut-3-enyl)phenyl]-3-[4-methoxy-3-(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 168878103 |
| Molecular Formula | C27H34O9 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(3-methylbut-3-enyl)phenyl]-3-[4-methoxy-3-(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | C=C(C)CCc1c(OCOC)cc(OCOC)c(C(=O)C=Cc2ccc(OC)c(OCOC)c2)c1O |
| InChI | InChI=1S/C27H34O9/c1-18(2)7-10-20-23(34-15-30-3)14-25(36-17-32-5)26(27(20)29)21(28)11-8-19-9-12-22(33-6)24(13-19)35-16-31-4/h8-9,11-14,29H,1,7,10,15-17H2,2-6H3 |
| InChIKey | JXVYMDCJEMAYOR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|