C24H28BrNO6 — CID 25208635
(E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(pyrrolidin-1-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 25208635) has the molecular formula C24H28BrNO6 and a molecular weight of 506.39 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(pyrrolidin-1-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(pyrrolidin-1-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 25208635 |
| Molecular Formula | C24H28BrNO6 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-bis(methoxymethoxy)-3-(pyrrolidin-1-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OCOC)c(C(=O)/C=C/c2cccc(Br)c2)c(O)c1CN1CCCC1 |
| InChI | InChI=1S/C24H28BrNO6/c1-29-15-31-21-13-22(32-16-30-2)23(24(28)19(21)14-26-10-3-4-11-26)20(27)9-8-17-6-5-7-18(25)12-17/h5-9,12-13,28H,3-4,10-11,14-16H2,1-2H3/b9-8+ |
| InChIKey | MRGSMFPDMZTBRR-CMDGGOBGSA-N |
| XLogP | 4.61 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|