C23H26BrNO4 — CID 46226339
(E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 46226339) has the molecular formula C23H26BrNO4 and a molecular weight of 460.37 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46226339 |
| Molecular Formula | C23H26BrNO4 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (E)-3-(3-bromophenyl)-1-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2cccc(Br)c2)c(O)c1CN1CCCCC1 |
| InChI | InChI=1S/C23H26BrNO4/c1-28-20-14-21(29-2)22(19(26)10-9-16-7-6-8-17(24)13-16)23(27)18(20)15-25-11-4-3-5-12-25/h6-10,13-14,27H,3-5,11-12,15H2,1-2H3/b10-9+ |
| InChIKey | MYGIOVRZEHOPRQ-MDZDMXLPSA-N |
| XLogP | 5.05 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|