C24H29NO5 — CID 8829961
(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one (PubChem CID 8829961) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8829961 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-methoxy-3-(piperidin-1-ylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(OC)c(O)c(OC)c2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C24H29NO5/c1-28-21-10-8-18(15-19(21)16-25-11-5-4-6-12-25)20(26)9-7-17-13-22(29-2)24(27)23(14-17)30-3/h7-10,13-15,27H,4-6,11-12,16H2,1-3H3/b9-7+ |
| InChIKey | JUWXZMLRUOMYPL-VQHVLOKHSA-N |
| XLogP | 4.30 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|