C26H33NO6 — CID 44600925
(E)-1-[4-ethoxy-2-hydroxy-5-(piperidin-1-ylmethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 44600925) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is (E)-1-[4-ethoxy-2-hydroxy-5-(piperidin-1-ylmethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-ethoxy-2-hydroxy-5-(piperidin-1-ylmethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 44600925 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (E)-1-[4-ethoxy-2-hydroxy-5-(piperidin-1-ylmethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(O)c(C(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C26H33NO6/c1-5-33-23-16-22(29)20(15-19(23)17-27-11-7-6-8-12-27)21(28)10-9-18-13-24(30-2)26(32-4)25(14-18)31-3/h9-10,13-16,29H,5-8,11-12,17H2,1-4H3/b10-9+ |
| InChIKey | TWJNFBKZSORNPU-MDZDMXLPSA-N |
| XLogP | 4.70 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|