C24H28ClNO3 — CID 44599167
(E)-3-(2-chlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one (PubChem CID 44599167) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44599167 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one |
| SMILES | CCOc1cc(O)c(C(=O)/C=C/c2ccccc2Cl)cc1CN1CCC(C)CC1 |
| InChI | InChI=1S/C24H28ClNO3/c1-3-29-24-15-23(28)20(14-19(24)16-26-12-10-17(2)11-13-26)22(27)9-8-18-6-4-5-7-21(18)25/h4-9,14-15,17,28H,3,10-13,16H2,1-2H3/b9-8+ |
| InChIKey | HGQVQVXDTPHGDG-CMDGGOBGSA-N |
| XLogP | 5.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|