C22H26ClNO3 — CID 44601241
(E)-3-(4-chlorophenyl)-1-[5-(diethylaminomethyl)-4-ethoxy-2-hydroxyphenyl]prop-2-en-1-one (PubChem CID 44601241) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[5-(diethylaminomethyl)-4-ethoxy-2-hydroxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[5-(diethylaminomethyl)-4-ethoxy-2-hydroxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44601241 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[5-(diethylaminomethyl)-4-ethoxy-2-hydroxyphenyl]prop-2-en-1-one |
| SMILES | CCOc1cc(O)c(C(=O)/C=C/c2ccc(Cl)cc2)cc1CN(CC)CC |
| InChI | InChI=1S/C22H26ClNO3/c1-4-24(5-2)15-17-13-19(21(26)14-22(17)27-6-3)20(25)12-9-16-7-10-18(23)11-8-16/h7-14,26H,4-6,15H2,1-3H3/b12-9+ |
| InChIKey | YYJYJNSCJCVGTD-FMIVXFBMSA-N |
| XLogP | 5.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|