C24H27Cl2NO3 — CID 44598993
(E)-3-(2,4-dichlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(2-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one (PubChem CID 44598993) has the molecular formula C24H27Cl2NO3 and a molecular weight of 448.39 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(2-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(2-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44598993 |
| Molecular Formula | C24H27Cl2NO3 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-1-[4-ethoxy-2-hydroxy-5-[(2-methylpiperidin-1-yl)methyl]phenyl]prop-2-en-1-one |
| SMILES | CCOc1cc(O)c(C(=O)/C=C/c2ccc(Cl)cc2Cl)cc1CN1CCCCC1C |
| InChI | InChI=1S/C24H27Cl2NO3/c1-3-30-24-14-23(29)20(12-18(24)15-27-11-5-4-6-16(27)2)22(28)10-8-17-7-9-19(25)13-21(17)26/h7-10,12-14,16,29H,3-6,11,15H2,1-2H3/b10-8+ |
| InChIKey | ITWPCCOAYGKNIS-CSKARUKUSA-N |
| XLogP | 6.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|