C20H23NO5 — CID 44578594
(E)-1-[4-ethoxy-2-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 44578594) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (E)-1-[4-ethoxy-2-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-ethoxy-2-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 44578594 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (E)-1-[4-ethoxy-2-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(O)c(C(=O)/C=C/c2ccco2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C20H23NO5/c1-2-25-20-13-19(23)17(18(22)6-5-16-4-3-9-26-16)12-15(20)14-21-7-10-24-11-8-21/h3-6,9,12-13,23H,2,7-8,10-11,14H2,1H3/b6-5+ |
| InChIKey | FOHOKHRIFMFYIC-AATRIKPKSA-N |
| XLogP | 3.11 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|