C12H14N2O3S — CID 2054544
(E)-3-(furan-2-yl)-N-(morpholine-4-carbothioyl)prop-2-enamide (PubChem CID 2054544) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(morpholine-4-carbothioyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(morpholine-4-carbothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 2054544 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(morpholine-4-carbothioyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)N1CCOCC1 |
| InChI | InChI=1S/C12H14N2O3S/c15-11(4-3-10-2-1-7-17-10)13-12(18)14-5-8-16-9-6-14/h1-4,7H,5-6,8-9H2,(H,13,15,18)/b4-3+ |
| InChIKey | WAFOBJSSMIVXRM-ONEGZZNKSA-N |
| XLogP | 1.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|