C14H21Cl2NO2 — CID 156723320
4,5-dichloro-2-[(2-methylpiperidin-1-yl)methyl]phenol;methanol (PubChem CID 156723320) has the molecular formula C14H21Cl2NO2 and a molecular weight of 306.23 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2-methylpiperidin-1-yl)methyl]phenol;methanol.
| Compound Name | 4,5-dichloro-2-[(2-methylpiperidin-1-yl)methyl]phenol;methanol |
|---|---|
| PubChem CID | 156723320 |
| Molecular Formula | C14H21Cl2NO2 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4,5-dichloro-2-[(2-methylpiperidin-1-yl)methyl]phenol;methanol |
| SMILES | CC1CCCCN1Cc1cc(Cl)c(Cl)cc1O.CO |
| InChI | InChI=1S/C13H17Cl2NO.CH4O/c1-9-4-2-3-5-16(9)8-10-6-11(14)12(15)7-13(10)17;1-2/h6-7,9,17H,2-5,8H2,1H3;2H,1H3 |
| InChIKey | AIBGIGSBHHSCKM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|