C12H15Cl2N — CID 141023901
1-[(2,3-dichlorophenyl)methyl]-2-methylpyrrolidine (PubChem CID 141023901) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-2-methylpyrrolidine.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 141023901 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-2-methylpyrrolidine |
| SMILES | CC1CCCN1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl2N/c1-9-4-3-7-15(9)8-10-5-2-6-11(13)12(10)14/h2,5-6,9H,3-4,7-8H2,1H3 |
| InChIKey | OARMOFJRBGLNIU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |