C11H11Cl2NO2 — CID 154747262
1-[(2,3-dichlorophenyl)methyl]azetidine-2-carboxylic acid (PubChem CID 154747262) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]azetidine-2-carboxylic acid.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 154747262 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]azetidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCN1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c12-8-3-1-2-7(10(8)13)6-14-5-4-9(14)11(15)16/h1-3,9H,4-6H2,(H,15,16) |
| InChIKey | MSNSUMFZGFFZKY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |