C12H14ClFN2O2 — CID 114488257
1-[(3-chloro-2-fluorophenyl)methyl]piperazine-2-carboxylic acid (PubChem CID 114488257) has the molecular formula C12H14ClFN2O2 and a molecular weight of 272.71 g/mol. Its IUPAC name is 1-[(3-chloro-2-fluorophenyl)methyl]piperazine-2-carboxylic acid.
| Compound Name | 1-[(3-chloro-2-fluorophenyl)methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 114488257 |
| Molecular Formula | C12H14ClFN2O2 |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-[(3-chloro-2-fluorophenyl)methyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H14ClFN2O2/c13-9-3-1-2-8(11(9)14)7-16-5-4-15-6-10(16)12(17)18/h1-3,10,15H,4-7H2,(H,17,18) |
| InChIKey | HVIAONPVMZWRMF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |