C10H13ClN4O2 — CID 71646339
1-[(6-chloropyridazin-3-yl)methyl]piperazine-2-carboxylic acid (PubChem CID 71646339) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 1-[(6-chloropyridazin-3-yl)methyl]piperazine-2-carboxylic acid.
| Compound Name | 1-[(6-chloropyridazin-3-yl)methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 71646339 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-[(6-chloropyridazin-3-yl)methyl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CNCCN1Cc1ccc(Cl)nn1 |
| InChI | InChI=1S/C10H13ClN4O2/c11-9-2-1-7(13-14-9)6-15-4-3-12-5-8(15)10(16)17/h1-2,8,12H,3-6H2,(H,16,17) |
| InChIKey | AUKIILFVYKRNCC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |