C10H13ClN4O2 — CID 104513819
4-[(6-chloropyridazin-3-yl)methyl]morpholine-3-carboxamide (PubChem CID 104513819) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 4-[(6-chloropyridazin-3-yl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(6-chloropyridazin-3-yl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 104513819 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 4-[(6-chloropyridazin-3-yl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1ccc(Cl)nn1 |
| InChI | InChI=1S/C10H13ClN4O2/c11-9-2-1-7(13-14-9)5-15-3-4-17-6-8(15)10(12)16/h1-2,8H,3-6H2,(H2,12,16) |
| InChIKey | WKMBRNKAVQJFCF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |