C12H16BrN3O2 — CID 83102348
4-[(2-amino-6-bromophenyl)methyl]morpholine-3-carboxamide (PubChem CID 83102348) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 4-[(2-amino-6-bromophenyl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(2-amino-6-bromophenyl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83102348 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-[(2-amino-6-bromophenyl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1c(N)cccc1Br |
| InChI | InChI=1S/C12H16BrN3O2/c13-9-2-1-3-10(14)8(9)6-16-4-5-18-7-11(16)12(15)17/h1-3,11H,4-7,14H2,(H2,15,17) |
| InChIKey | LQLSVJBMHAQRAQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|