C12H16N4O4 — CID 83095659
4-[(2-amino-5-nitrophenyl)methyl]morpholine-3-carboxamide (PubChem CID 83095659) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-[(2-amino-5-nitrophenyl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(2-amino-5-nitrophenyl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095659 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-[(2-amino-5-nitrophenyl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1Cc1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C12H16N4O4/c13-10-2-1-9(16(18)19)5-8(10)6-15-3-4-20-7-11(15)12(14)17/h1-2,5,11H,3-4,6-7,13H2,(H2,14,17) |
| InChIKey | CTBSWIGSHAGAPA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|