C13H18N4O3 — CID 83101795
4-[(2-amino-4-carbamoylphenyl)methyl]morpholine-3-carboxamide (PubChem CID 83101795) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[(2-amino-4-carbamoylphenyl)methyl]morpholine-3-carboxamide.
| Compound Name | 4-[(2-amino-4-carbamoylphenyl)methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83101795 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-[(2-amino-4-carbamoylphenyl)methyl]morpholine-3-carboxamide |
| SMILES | NC(=O)c1ccc(CN2CCOCC2C(N)=O)c(N)c1 |
| InChI | InChI=1S/C13H18N4O3/c14-10-5-8(12(15)18)1-2-9(10)6-17-3-4-20-7-11(17)13(16)19/h1-2,5,11H,3-4,6-7,14H2,(H2,15,18)(H2,16,19) |
| InChIKey | ZWYKCMOQRBNPHW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|