C20H23N3O4 — CID 170764378
(3S)-4-[[3-(4-carbamoyl-2-methylphenyl)-5-hydroxyphenyl]methyl]morpholine-3-carboxamide (PubChem CID 170764378) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (3S)-4-[[3-(4-carbamoyl-2-methylphenyl)-5-hydroxyphenyl]methyl]morpholine-3-carboxamide.
| Compound Name | (3S)-4-[[3-(4-carbamoyl-2-methylphenyl)-5-hydroxyphenyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 170764378 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3S)-4-[[3-(4-carbamoyl-2-methylphenyl)-5-hydroxyphenyl]methyl]morpholine-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)ccc1-c1cc(O)cc(CN2CCOC[C@H]2C(N)=O)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-12-6-14(19(21)25)2-3-17(12)15-7-13(8-16(24)9-15)10-23-4-5-27-11-18(23)20(22)26/h2-3,6-9,18,24H,4-5,10-11H2,1H3,(H2,21,25)(H2,22,26)/t18-/m0/s1 |
| InChIKey | LVFZBOAJHDBLRZ-SFHVURJKSA-N |
| XLogP | 1.15 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |