C29H36N6O4 — CID 170764322
N-[1-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]ethyl]formamide;4-[3-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-methylbenzamide (PubChem CID 170764322) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is N-[1-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]ethyl]formamide;4-[3-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-methylbenzamide.
| Compound Name | N-[1-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]ethyl]formamide;4-[3-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 170764322 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | N-[1-[4-[(Z)-C-aminocarbonohydrazonoyl]phenyl]ethyl]formamide;4-[3-hydroxy-5-(morpholin-4-ylmethyl)phenyl]-3-methylbenzamide |
| SMILES | CC(NC=O)c1ccc(/C(N)=N/N)cc1.Cc1cc(C(N)=O)ccc1-c1cc(O)cc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C19H22N2O3.C10H14N4O/c1-13-8-15(19(20)23)2-3-18(13)16-9-14(10-17(22)11-16)12-21-4-6-24-7-5-21;1-7(13-6-15)8-2-4-9(5-3-8)10(11)14-12/h2-3,8-11,22H,4-7,12H2,1H3,(H2,20,23);2-7H,12H2,1H3,(H2,11,14)(H,13,15) |
| InChIKey | QCEXALWRGZOIKK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 169.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|