C27H31N2O5S+ — CID 170764299
4-[1-[4-[[3-hydroxy-5-(2-methyl-4-sulfinamoylphenyl)phenyl]methyl]morpholin-4-ium-4-yl]ethyl]benzoic acid (PubChem CID 170764299) has the molecular formula C27H31N2O5S+ and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-[1-[4-[[3-hydroxy-5-(2-methyl-4-sulfinamoylphenyl)phenyl]methyl]morpholin-4-ium-4-yl]ethyl]benzoic acid.
| Compound Name | 4-[1-[4-[[3-hydroxy-5-(2-methyl-4-sulfinamoylphenyl)phenyl]methyl]morpholin-4-ium-4-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 170764299 |
| Molecular Formula | C27H31N2O5S+ |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[1-[4-[[3-hydroxy-5-(2-methyl-4-sulfinamoylphenyl)phenyl]methyl]morpholin-4-ium-4-yl]ethyl]benzoic acid |
| SMILES | Cc1cc(S(N)=O)ccc1-c1cc(O)cc(C[N+]2(C(C)c3ccc(C(=O)O)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C27H30N2O5S/c1-18-13-25(35(28)33)7-8-26(18)23-14-20(15-24(30)16-23)17-29(9-11-34-12-10-29)19(2)21-3-5-22(6-4-21)27(31)32/h3-8,13-16,19H,9-12,17,28H2,1-2H3,(H-,30,31,32)/p+1 |
| InChIKey | MXUXXDYEKCTVHP-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|