C20H25N3O3 — CID 174258423
4-[3-[[3-(aminomethyl)morpholin-4-yl]methyl]-5-hydroxyphenyl]-3-methylbenzamide (PubChem CID 174258423) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-[3-[[3-(aminomethyl)morpholin-4-yl]methyl]-5-hydroxyphenyl]-3-methylbenzamide.
| Compound Name | 4-[3-[[3-(aminomethyl)morpholin-4-yl]methyl]-5-hydroxyphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 174258423 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 4-[3-[[3-(aminomethyl)morpholin-4-yl]methyl]-5-hydroxyphenyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1-c1cc(O)cc(CN2CCOCC2CN)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-6-15(20(22)25)2-3-19(13)16-7-14(8-18(24)9-16)11-23-4-5-26-12-17(23)10-21/h2-3,6-9,17,24H,4-5,10-12,21H2,1H3,(H2,22,25) |
| InChIKey | JTROHGKJBXTKNS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |