4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid

C15H15NO4 — CID 107705412

IUPAC4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cc(O)cc(O)c1
InChIInChI=1S/C15H15NO4/c1-9(11-6-13(17)8-14(18)7-11)16-12-4-2-10(3-5-12)15(19)20/h2-9,16-18H,1H3,(H,19,20)
InChIKeyQMMFFGDYRMYERR-UHFFFAOYSA-N
MW273.29 g/mol
LogP2.97
Rot. Bonds4

About 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid

4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid (PubChem CID 107705412) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid
PubChem CID107705412
Molecular FormulaC15H15NO4
Molecular Weight273.29 g/mol
Exact Mass273.10
IUPAC Name4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cc(O)cc(O)c1
InChIInChI=1S/C15H15NO4/c1-9(11-6-13(17)8-14(18)7-11)16-12-4-2-10(3-5-12)15(19)20/h2-9,16-18H,1H3,(H,19,20)
InChIKeyQMMFFGDYRMYERR-UHFFFAOYSA-N
XLogP2.97
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 52.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid?
The IUPAC name of 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid (CID 107705412) is 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid.
What is the SMILES notation for 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid?
The canonical SMILES for 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid is CC(Nc1ccc(C(=O)O)cc1)c1cc(O)cc(O)c1.
What is the InChIKey of 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid?
The InChIKey is QMMFFGDYRMYERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-9(11-6-13(17)8-14(18)7-11)16-12-4-2-10(3-5-12)15(19)20/h2-9,16-18H,1H3,(H,19,20).
What are the key properties of 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid?
4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid has a molecular weight of 273.29 g/mol, XLogP of 2.97, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,5-dihydroxyphenyl)ethylamino]benzoic acid is sourced from PubChem (CID 107705412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).