4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid

C16H14N2O2S — CID 64828980

IUPAC4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cnc2ccsc2c1
InChIInChI=1S/C16H14N2O2S/c1-10(12-8-15-14(17-9-12)6-7-21-15)18-13-4-2-11(3-5-13)16(19)20/h2-10,18H,1H3,(H,19,20)
InChIKeyWDXCCPFVGCEECY-UHFFFAOYSA-N
MW298.37 g/mol
LogP4.17
Rot. Bonds4

About 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid

4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid (PubChem CID 64828980) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid.

Molecular Properties

Compound Name4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid
PubChem CID64828980
Molecular FormulaC16H14N2O2S
Molecular Weight298.37 g/mol
Exact Mass298.08
IUPAC Name4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid
SMILESCC(Nc1ccc(C(=O)O)cc1)c1cnc2ccsc2c1
InChIInChI=1S/C16H14N2O2S/c1-10(12-8-15-14(17-9-12)6-7-21-15)18-13-4-2-11(3-5-13)16(19)20/h2-10,18H,1H3,(H,19,20)
InChIKeyWDXCCPFVGCEECY-UHFFFAOYSA-N
XLogP4.17
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.37
LogP ≤ 54.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid?
The IUPAC name of 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid (CID 64828980) is 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid.
What is the SMILES notation for 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid?
The canonical SMILES for 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid is CC(Nc1ccc(C(=O)O)cc1)c1cnc2ccsc2c1.
What is the InChIKey of 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid?
The InChIKey is WDXCCPFVGCEECY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2S/c1-10(12-8-15-14(17-9-12)6-7-21-15)18-13-4-2-11(3-5-13)16(19)20/h2-10,18H,1H3,(H,19,20).
What are the key properties of 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid?
4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid has a molecular weight of 298.37 g/mol, XLogP of 4.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzoic acid is sourced from PubChem (CID 64828980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).