C20H12N2O2S — CID 58437368
4-(3-cyano-5-thiophen-2-ylindol-1-yl)benzoic acid (PubChem CID 58437368) has the molecular formula C20H12N2O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-(3-cyano-5-thiophen-2-ylindol-1-yl)benzoic acid.
| Compound Name | 4-(3-cyano-5-thiophen-2-ylindol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 58437368 |
| Molecular Formula | C20H12N2O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-(3-cyano-5-thiophen-2-ylindol-1-yl)benzoic acid |
| SMILES | N#Cc1cn(-c2ccc(C(=O)O)cc2)c2ccc(-c3cccs3)cc12 |
| InChI | InChI=1S/C20H12N2O2S/c21-11-15-12-22(16-6-3-13(4-7-16)20(23)24)18-8-5-14(10-17(15)18)19-2-1-9-25-19/h1-10,12H,(H,23,24) |
| InChIKey | ZSXPHTRDHVFXCW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |