C21H14N2O3S — CID 58437216
4-[3-cyano-5-(thiophen-2-ylmethoxy)indol-1-yl]benzoic acid (PubChem CID 58437216) has the molecular formula C21H14N2O3S and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[3-cyano-5-(thiophen-2-ylmethoxy)indol-1-yl]benzoic acid.
| Compound Name | 4-[3-cyano-5-(thiophen-2-ylmethoxy)indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 58437216 |
| Molecular Formula | C21H14N2O3S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 4-[3-cyano-5-(thiophen-2-ylmethoxy)indol-1-yl]benzoic acid |
| SMILES | N#Cc1cn(-c2ccc(C(=O)O)cc2)c2ccc(OCc3cccs3)cc12 |
| InChI | InChI=1S/C21H14N2O3S/c22-11-15-12-23(16-5-3-14(4-6-16)21(24)25)20-8-7-17(10-19(15)20)26-13-18-2-1-9-27-18/h1-10,12H,13H2,(H,24,25) |
| InChIKey | YXFWLSVWSAXUJP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |