C26H25ClN2O2S — CID 10205121
3-[[4-[1-[(5-chlorothiophen-2-yl)methyl]indol-3-yl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 10205121) has the molecular formula C26H25ClN2O2S and a molecular weight of 465.02 g/mol. Its IUPAC name is 3-[[4-[1-[(5-chlorothiophen-2-yl)methyl]indol-3-yl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[1-[(5-chlorothiophen-2-yl)methyl]indol-3-yl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10205121 |
| Molecular Formula | C26H25ClN2O2S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 3-[[4-[1-[(5-chlorothiophen-2-yl)methyl]indol-3-yl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(c3cn(Cc4ccc(Cl)s4)c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C26H25ClN2O2S/c27-25-9-8-21(32-25)16-29-17-23(22-6-1-2-7-24(22)29)19-10-12-28(13-11-19)15-18-4-3-5-20(14-18)26(30)31/h1-9,14,17,19H,10-13,15-16H2,(H,30,31) |
| InChIKey | KOKZGSUQOORKGT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |