C18H15ClN2O2S — CID 162669933
5-[1-(2-chloro-6-methylsulfanyl-4-pyridinyl)ethenyl]-1-methylindole-3-carboxylic acid (PubChem CID 162669933) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is 5-[1-(2-chloro-6-methylsulfanyl-4-pyridinyl)ethenyl]-1-methylindole-3-carboxylic acid.
| Compound Name | 5-[1-(2-chloro-6-methylsulfanyl-4-pyridinyl)ethenyl]-1-methylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 162669933 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-[1-(2-chloro-6-methylsulfanyl-4-pyridinyl)ethenyl]-1-methylindole-3-carboxylic acid |
| SMILES | C=C(c1cc(Cl)nc(SC)c1)c1ccc2c(c1)c(C(=O)O)cn2C |
| InChI | InChI=1S/C18H15ClN2O2S/c1-10(12-7-16(19)20-17(8-12)24-3)11-4-5-15-13(6-11)14(18(22)23)9-21(15)2/h4-9H,1H2,2-3H3,(H,22,23) |
| InChIKey | GKHJEVVMMDWNSG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|