C14H13Cl2NO2 — CID 107704974
5-[1-(3,4-dichloroanilino)ethyl]benzene-1,3-diol (PubChem CID 107704974) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is 5-[1-(3,4-dichloroanilino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(3,4-dichloroanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107704974 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-[1-(3,4-dichloroanilino)ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1ccc(Cl)c(Cl)c1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H13Cl2NO2/c1-8(9-4-11(18)7-12(19)5-9)17-10-2-3-13(15)14(16)6-10/h2-8,17-19H,1H3 |
| InChIKey | OLSRGJPYEBKNMW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |