C15H17NO3 — CID 107707113
5-[1-[4-(hydroxymethyl)anilino]ethyl]benzene-1,3-diol (PubChem CID 107707113) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-[1-[4-(hydroxymethyl)anilino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[4-(hydroxymethyl)anilino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707113 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-[1-[4-(hydroxymethyl)anilino]ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1ccc(CO)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10(12-6-14(18)8-15(19)7-12)16-13-4-2-11(9-17)3-5-13/h2-8,10,16-19H,9H2,1H3 |
| InChIKey | LGTIPMNPNMQUJE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |