C15H18N2O3 — CID 107706094
5-[1-(3,5-dihydroxyphenyl)ethylamino]-1-ethylpyridin-2-one (PubChem CID 107706094) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[1-(3,5-dihydroxyphenyl)ethylamino]-1-ethylpyridin-2-one.
| Compound Name | 5-[1-(3,5-dihydroxyphenyl)ethylamino]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 107706094 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 5-[1-(3,5-dihydroxyphenyl)ethylamino]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(NC(C)c2cc(O)cc(O)c2)ccc1=O |
| InChI | InChI=1S/C15H18N2O3/c1-3-17-9-12(4-5-15(17)20)16-10(2)11-6-13(18)8-14(19)7-11/h4-10,16,18-19H,3H2,1-2H3 |
| InChIKey | APGXFXAMYGLEOO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |