C15H16F2N2O — CID 60942405
5-[1-(2,5-difluorophenyl)ethylamino]-1-ethylpyridin-2-one (PubChem CID 60942405) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-[1-(2,5-difluorophenyl)ethylamino]-1-ethylpyridin-2-one.
| Compound Name | 5-[1-(2,5-difluorophenyl)ethylamino]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 60942405 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-[1-(2,5-difluorophenyl)ethylamino]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(NC(C)c2cc(F)ccc2F)ccc1=O |
| InChI | InChI=1S/C15H16F2N2O/c1-3-19-9-12(5-7-15(19)20)18-10(2)13-8-11(16)4-6-14(13)17/h4-10,18H,3H2,1-2H3 |
| InChIKey | DMOPOTBNRIHDJO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |