2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid

C15H12ClF2NO2 — CID 43736287

IUPAC2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(Cl)c(C(=O)O)c1)c1cc(F)ccc1F
InChIInChI=1S/C15H12ClF2NO2/c1-8(11-6-9(17)2-5-14(11)18)19-10-3-4-13(16)12(7-10)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyBIVZYIYGDBZCCK-UHFFFAOYSA-N
MW311.72 g/mol
LogP4.49
Rot. Bonds4

About 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid

2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid (PubChem CID 43736287) has the molecular formula C15H12ClF2NO2 and a molecular weight of 311.72 g/mol. Its IUPAC name is 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid
PubChem CID43736287
Molecular FormulaC15H12ClF2NO2
Molecular Weight311.72 g/mol
Exact Mass311.05
IUPAC Name2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(Cl)c(C(=O)O)c1)c1cc(F)ccc1F
InChIInChI=1S/C15H12ClF2NO2/c1-8(11-6-9(17)2-5-14(11)18)19-10-3-4-13(16)12(7-10)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyBIVZYIYGDBZCCK-UHFFFAOYSA-N
XLogP4.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.72
LogP ≤ 54.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid?
The IUPAC name of 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid (CID 43736287) is 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid.
What is the SMILES notation for 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid?
The canonical SMILES for 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid is CC(Nc1ccc(Cl)c(C(=O)O)c1)c1cc(F)ccc1F.
What is the InChIKey of 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid?
The InChIKey is BIVZYIYGDBZCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2NO2/c1-8(11-6-9(17)2-5-14(11)18)19-10-3-4-13(16)12(7-10)15(20)21/h2-8,19H,1H3,(H,20,21).
What are the key properties of 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid?
2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid has a molecular weight of 311.72 g/mol, XLogP of 4.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[1-(2,5-difluorophenyl)ethylamino]benzoic acid is sourced from PubChem (CID 43736287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).