C15H14FNO4 — CID 43727942
5-[1-(2,5-dihydroxyphenyl)ethylamino]-2-fluorobenzoic acid (PubChem CID 43727942) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is 5-[1-(2,5-dihydroxyphenyl)ethylamino]-2-fluorobenzoic acid.
| Compound Name | 5-[1-(2,5-dihydroxyphenyl)ethylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 43727942 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5-[1-(2,5-dihydroxyphenyl)ethylamino]-2-fluorobenzoic acid |
| SMILES | CC(Nc1ccc(F)c(C(=O)O)c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H14FNO4/c1-8(11-7-10(18)3-5-14(11)19)17-9-2-4-13(16)12(6-9)15(20)21/h2-8,17-19H,1H3,(H,20,21) |
| InChIKey | ODUSUSMJBMNKQB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|