C27H31N3O4S — CID 170764158
2-(4-aminosulfanylphenyl)-4-(pyrrolidin-1-ylmethyl)phenol;4-(1-formamidoethyl)benzoic acid (PubChem CID 170764158) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-(4-aminosulfanylphenyl)-4-(pyrrolidin-1-ylmethyl)phenol;4-(1-formamidoethyl)benzoic acid.
| Compound Name | 2-(4-aminosulfanylphenyl)-4-(pyrrolidin-1-ylmethyl)phenol;4-(1-formamidoethyl)benzoic acid |
|---|---|
| PubChem CID | 170764158 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-(4-aminosulfanylphenyl)-4-(pyrrolidin-1-ylmethyl)phenol;4-(1-formamidoethyl)benzoic acid |
| SMILES | CC(NC=O)c1ccc(C(=O)O)cc1.NSc1ccc(-c2cc(CN3CCCC3)ccc2O)cc1 |
| InChI | InChI=1S/C17H20N2OS.C10H11NO3/c18-21-15-6-4-14(5-7-15)16-11-13(3-8-17(16)20)12-19-9-1-2-10-19;1-7(11-6-12)8-2-4-9(5-3-8)10(13)14/h3-8,11,20H,1-2,9-10,12,18H2;2-7H,1H3,(H,11,12)(H,13,14) |
| InChIKey | DYSUTQXBHDQORM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|