C22H23ClN2O — CID 135888231
4-(7-chloroquinolin-4-yl)-2-[[(2R)-2-methylpiperidin-1-yl]methyl]phenol (PubChem CID 135888231) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-(7-chloroquinolin-4-yl)-2-[[(2R)-2-methylpiperidin-1-yl]methyl]phenol.
| Compound Name | 4-(7-chloroquinolin-4-yl)-2-[[(2R)-2-methylpiperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 135888231 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-(7-chloroquinolin-4-yl)-2-[[(2R)-2-methylpiperidin-1-yl]methyl]phenol |
| SMILES | C[C@@H]1CCCCN1Cc1cc(-c2ccnc3cc(Cl)ccc23)ccc1O |
| InChI | InChI=1S/C22H23ClN2O/c1-15-4-2-3-11-25(15)14-17-12-16(5-8-22(17)26)19-9-10-24-21-13-18(23)6-7-20(19)21/h5-10,12-13,15,26H,2-4,11,14H2,1H3/t15-/m1/s1 |
| InChIKey | YUVFHXMHAVVPMS-OAHLLOKOSA-N |
| XLogP | 5.64 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|