C20H27N3O — CID 135914453
4-(3,6-dimethylpyrazin-2-yl)-2-[(2-ethylpiperidin-1-yl)methyl]phenol (PubChem CID 135914453) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 4-(3,6-dimethylpyrazin-2-yl)-2-[(2-ethylpiperidin-1-yl)methyl]phenol.
| Compound Name | 4-(3,6-dimethylpyrazin-2-yl)-2-[(2-ethylpiperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 135914453 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 4-(3,6-dimethylpyrazin-2-yl)-2-[(2-ethylpiperidin-1-yl)methyl]phenol |
| SMILES | CCC1CCCCN1Cc1cc(-c2nc(C)cnc2C)ccc1O |
| InChI | InChI=1S/C20H27N3O/c1-4-18-7-5-6-10-23(18)13-17-11-16(8-9-19(17)24)20-15(3)21-12-14(2)22-20/h8-9,11-12,18,24H,4-7,10,13H2,1-3H3 |
| InChIKey | FODYTSYRVHIWNM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|