C19H24N2O — CID 135950417
2-[[(2R)-2-ethylpiperidin-1-yl]methyl]-4-pyridin-2-ylphenol (PubChem CID 135950417) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[[(2R)-2-ethylpiperidin-1-yl]methyl]-4-pyridin-2-ylphenol.
| Compound Name | 2-[[(2R)-2-ethylpiperidin-1-yl]methyl]-4-pyridin-2-ylphenol |
|---|---|
| PubChem CID | 135950417 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-[[(2R)-2-ethylpiperidin-1-yl]methyl]-4-pyridin-2-ylphenol |
| SMILES | CC[C@@H]1CCCCN1Cc1cc(-c2ccccn2)ccc1O |
| InChI | InChI=1S/C19H24N2O/c1-2-17-7-4-6-12-21(17)14-16-13-15(9-10-19(16)22)18-8-3-5-11-20-18/h3,5,8-11,13,17,22H,2,4,6-7,12,14H2,1H3/t17-/m1/s1 |
| InChIKey | FSYKIRIYZLTRTG-QGZVFWFLSA-N |
| XLogP | 4.22 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|