C24H27NO2S3 — CID 139658150
5-[4-hydroxy-3-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione (PubChem CID 139658150) has the molecular formula C24H27NO2S3 and a molecular weight of 457.69 g/mol. Its IUPAC name is 5-[4-hydroxy-3-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione |
|---|---|
| PubChem CID | 139658150 |
| Molecular Formula | C24H27NO2S3 |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 5-[4-hydroxy-3-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione |
| SMILES | Cc1ccc(-c2c(-c3ccc(O)c(CN4CCCCC4CCO)c3)ssc2=S)cc1 |
| InChI | InChI=1S/C24H27NO2S3/c1-16-5-7-17(8-6-16)22-23(29-30-24(22)28)18-9-10-21(27)19(14-18)15-25-12-3-2-4-20(25)11-13-26/h5-10,14,20,26-27H,2-4,11-13,15H2,1H3 |
| InChIKey | UQGXUGWWACCDPE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|