C17H21NO2S3 — CID 139657848
4-ethyl-5-[4-hydroxy-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]dithiole-3-thione (PubChem CID 139657848) has the molecular formula C17H21NO2S3 and a molecular weight of 367.56 g/mol. Its IUPAC name is 4-ethyl-5-[4-hydroxy-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-ethyl-5-[4-hydroxy-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657848 |
| Molecular Formula | C17H21NO2S3 |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-ethyl-5-[4-hydroxy-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]dithiole-3-thione |
| SMILES | CCc1c(-c2ccc(O)c(CN3CCC(O)CC3)c2)ssc1=S |
| InChI | InChI=1S/C17H21NO2S3/c1-2-14-16(22-23-17(14)21)11-3-4-15(20)12(9-11)10-18-7-5-13(19)6-8-18/h3-4,9,13,19-20H,2,5-8,10H2,1H3 |
| InChIKey | MEBXBXWEVAIWTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|