C22H32N2OS3 — CID 139657879
4-hexyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione (PubChem CID 139657879) has the molecular formula C22H32N2OS3 and a molecular weight of 436.71 g/mol. Its IUPAC name is 4-hexyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-hexyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657879 |
| Molecular Formula | C22H32N2OS3 |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-hexyl-5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]dithiole-3-thione |
| SMILES | CCCCCCc1c(-c2ccc(O)c(CN3CCCN(C)CC3)c2)ssc1=S |
| InChI | InChI=1S/C22H32N2OS3/c1-3-4-5-6-8-19-21(27-28-22(19)26)17-9-10-20(25)18(15-17)16-24-12-7-11-23(2)13-14-24/h9-10,15,25H,3-8,11-14,16H2,1-2H3 |
| InChIKey | RRRCAQRVMYJYMI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|