C37H44Cl2N4OS3 — CID 139657900
5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione (PubChem CID 139657900) has the molecular formula C37H44Cl2N4OS3 and a molecular weight of 727.89 g/mol. Its IUPAC name is 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione.
| Compound Name | 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione |
|---|---|
| PubChem CID | 139657900 |
| Molecular Formula | C37H44Cl2N4OS3 |
| Molecular Weight | 727.89 g/mol |
| Exact Mass | 726.21 |
| IUPAC Name | 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-butyldithiole-3-thione |
| SMILES | CCCCc1c(-c2cc(CN3CCN(Cc4ccc(Cl)cc4)CC3)c(O)c(CN3CCN(Cc4ccc(Cl)cc4)CC3)c2)ssc1=S |
| InChI | InChI=1S/C37H44Cl2N4OS3/c1-2-3-4-34-36(46-47-37(34)45)29-21-30(25-42-17-13-40(14-18-42)23-27-5-9-32(38)10-6-27)35(44)31(22-29)26-43-19-15-41(16-20-43)24-28-7-11-33(39)12-8-28/h5-12,21-22,44H,2-4,13-20,23-26H2,1H3 |
| InChIKey | CIXCUCGIJIULTM-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.89 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|