C33H46N4OS3 — CID 139657804
5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione (PubChem CID 139657804) has the molecular formula C33H46N4OS3 and a molecular weight of 610.96 g/mol. Its IUPAC name is 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione.
| Compound Name | 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione |
|---|---|
| PubChem CID | 139657804 |
| Molecular Formula | C33H46N4OS3 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 5-[3,5-bis[(4-butylpiperazin-1-yl)methyl]-4-hydroxyphenyl]-4-phenyldithiole-3-thione |
| SMILES | CCCCN1CCN(Cc2cc(-c3ssc(=S)c3-c3ccccc3)cc(CN3CCN(CCCC)CC3)c2O)CC1 |
| InChI | InChI=1S/C33H46N4OS3/c1-3-5-12-34-14-18-36(19-15-34)24-28-22-27(32-30(33(39)41-40-32)26-10-8-7-9-11-26)23-29(31(28)38)25-37-20-16-35(17-21-37)13-6-4-2/h7-11,22-23,38H,3-6,12-21,24-25H2,1-2H3 |
| InChIKey | JERJDRRIZGPNQZ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|