C40H42Cl2N4OS3 — CID 139657924
5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-(4-methylphenyl)dithiole-3-thione (PubChem CID 139657924) has the molecular formula C40H42Cl2N4OS3 and a molecular weight of 761.91 g/mol. Its IUPAC name is 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-(4-methylphenyl)dithiole-3-thione.
| Compound Name | 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-(4-methylphenyl)dithiole-3-thione |
|---|---|
| PubChem CID | 139657924 |
| Molecular Formula | C40H42Cl2N4OS3 |
| Molecular Weight | 761.91 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 5-[3,5-bis[[4-[(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-4-hydroxyphenyl]-4-(4-methylphenyl)dithiole-3-thione |
| SMILES | Cc1ccc(-c2c(-c3cc(CN4CCN(Cc5ccc(Cl)cc5)CC4)c(O)c(CN4CCN(Cc5ccc(Cl)cc5)CC4)c3)ssc2=S)cc1 |
| InChI | InChI=1S/C40H42Cl2N4OS3/c1-28-2-8-31(9-3-28)37-39(49-50-40(37)48)32-22-33(26-45-18-14-43(15-19-45)24-29-4-10-35(41)11-5-29)38(47)34(23-32)27-46-20-16-44(17-21-46)25-30-6-12-36(42)13-7-30/h2-13,22-23,47H,14-21,24-27H2,1H3 |
| InChIKey | HBJVIAIXHMDSDG-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.91 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|