C42H48N4O3S3 — CID 139657778
4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione (PubChem CID 139657778) has the molecular formula C42H48N4O3S3 and a molecular weight of 753.07 g/mol. Its IUPAC name is 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione.
| Compound Name | 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139657778 |
| Molecular Formula | C42H48N4O3S3 |
| Molecular Weight | 753.07 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | 4-benzyl-5-[4-hydroxy-3,5-bis[[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
| SMILES | COc1ccccc1CN1CCN(Cc2cc(-c3ssc(=S)c3Cc3ccccc3)cc(CN3CCN(Cc4ccccc4OC)CC3)c2O)CC1 |
| InChI | InChI=1S/C42H48N4O3S3/c1-48-38-14-8-6-12-32(38)27-43-16-20-45(21-17-43)29-35-25-34(41-37(42(50)52-51-41)24-31-10-4-3-5-11-31)26-36(40(35)47)30-46-22-18-44(19-23-46)28-33-13-7-9-15-39(33)49-2/h3-15,25-26,47H,16-24,27-30H2,1-2H3 |
| InChIKey | PTLLZTVRCRPGEM-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 51.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.07 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|